1/26/25, 12:38 AM Carbon & its Compounds (Made by Super ᑎOᐯᗩ) | Quizizz
Worksheets
Name
Carbon & its Compounds (Made by Super
ᑎOᐯᗩ) Class
Total questions: 25
Worksheet time: 13mins
Date
Instructor name: Om Joshi
1.
How many bonds will a C atom form?
a) 4 b) 2
c) 1 d) 3
2. Covalent compounds
a) have high melting and boiling point b) are mostly soluble in water
c) are formed between atoms of metals and non- d) are formed by the sharing of electrons in the
metals bonding atoms.
3. Which of the following is true for all hydrocarbon?
a) They have carbon and hydrogen atoms only b) They are in the same homologous series.
in the molecule.
c) They have carbon, oxygen and hydrogen d) They are saturated compounds.
atoms in the molecule.
4. Which of the following is the most important source of organic carbon compounds?
a) Animals b) Petroleum
c) Coal d) Plants
https://quizizz.com/print/quiz/679521de3076c00c23c3e16b 1/5
1/26/25, 12:38 AM Carbon & its Compounds (Made by Super ᑎOᐯᗩ) | Quizizz
5. Which of the following is an alkane?
a) C5H12 b) C3H6
c) C4H8 d) C6H12
6. What are the products formed when propane is burnt in excess oxygen?
a) Carbon monoxide and hydrogen b) Carbon monoxide and water
c) Carbon and hydrogen d) Carbon dioxide and water
7. Which of the following compound is saturated hydrocarbon?
I CH3CH2CH2CH3
II CH3CHC(CH3)2
III CH3CH2CH(CH3)2
IV CH3CHCHCH3
a) I, II and III b) I and III
c) I, III and IV d) II and IV
8. While cooking, if the bottom of the vessel is getting blackened on the outside, it means that:
a) The food is not cooked completely b) The fuel is burning completely
c) The fuel is not burning completely d) The fuel is wet
9. Cation is formed when
a) Atom gains electrons b) Atom shares electrons
c) Atom loses electrons d) Proton is lost by the atom
10. Which of the following is the molecular formula of cyclobutane?
a) C4H4 b) C4H10
c) C4H8 d) C4H6
11. The property of self-linkage among identical atoms to form long chain compounds is known
a) Superposition b) Halogenation
c) Catenation d) Isomerisation
https://quizizz.com/print/quiz/679521de3076c00c23c3e16b 2/5
1/26/25, 12:38 AM Carbon & its Compounds (Made by Super ᑎOᐯᗩ) | Quizizz
12. Which of the followings is the major constituent of the liquefied petroleum gas?
a) Ethane b) Butane
c) Methane d) Propane
13. From which of the following substance pencil lead is formed?
a) Lead b) Charcoal
c) Wood d) Graphite
14. -Methane is a major constituent of
a) All the above b) CNG
c) Natural Gas d) Bio-gas
15. Covalent bonds
a) All of the above b) are generally poor conductors of electricity
c) have low melting and boiling point d) have weak inter-molecular forces
16. Atomic No. of Carbon,No. of Electron,No. of Proton,No of electron is
a) 6 b) 7
c) 12 d) 4
17. How many H-atoms are in Benzene?
a) 6 b) 8
c) 12 d) 4
18. Allotrope of carbon and their state are
a) Diamond and Graphite/Amorphous and b) Diamond and Graphite/Amorphous and
Chlorised Liquid
c) Graphite and Diamond/Crysalline and d) Graphite,Hydrogen/Solid and Liquid
Amorphous
19. General formula of Alkyl group is
a) CnH2n+2 b) CnH2n+1
c) CnH2n d) CnH2n-2
https://quizizz.com/print/quiz/679521de3076c00c23c3e16b 3/5
1/26/25, 12:38 AM Carbon & its Compounds (Made by Super ᑎOᐯᗩ) | Quizizz
20. Prefix 'But' is used when no. of carbon are
a) 3 b) 5
c) 1 d) 4
21.
Name this compound (i made the question lol)
a) 6-iodo-3,4-dichloro-heptan-oic acid b) 3,4-dichloro-6-iodo-heptan-al
c) 6-iodo-3-chloro-4-chloro-heptan-oic acid d) 3,4-dichloro-6-iodo-heptan-oic acid
22. Name this compound
CH3-CH2-CH(CH3)-CH2-CH2OH
a) 2-Methylhexanol b) 2-Methylpentanol
c) 5-Methylhexanol d) 3-Methylpentanol
23. CH3-CH(CH3)-CH2-CH(CH3)-CH3
a) 2,4-Dimethylpentane b) 2,3-Dimethylhexane
c) 2,3-Dimethylpentane d) 3,4-Dimethylpentane
24. Assertion(A): n-butane and iso-butane are examples of isomers.
Reason (R) : Isomerism is possible only with hydrocarbons having 4 or more carbon atoms.
a) A is false but R is true b) A is true but R is false
c) Both A and R are true but R is not the correct d) Both A and R are true and R is the correct
explanation of A explanation of A.
https://quizizz.com/print/quiz/679521de3076c00c23c3e16b 4/5
1/26/25, 12:38 AM Carbon & its Compounds (Made by Super ᑎOᐯᗩ) | Quizizz
25. Assertion(A): The functional group present in alcohols is – OH.
Reason (R) : It is the same group as present in water, hence water and alcohol have similar
properties
a) A is true but R is false b) Both A and R are true and R is the correct
explanation of A
c) Both A and R are true but R is not the correct d) A is false but R is true
explanation of A
https://quizizz.com/print/quiz/679521de3076c00c23c3e16b 5/5
